Birken-nots

What is Birken-nots?

Cheap ass sandals that look similar to the uber comfy birkenstocks but can be purchased at Walmart etc.

Heard a rumor k-mart had birkenstocks but they were just birken-nots

See sandals, shoes, birkenstocks, birkies, foofy

Zivo'ed

1. Originating in the gay communities surrounding Market St. in San Francisco in the later part of 2008, the term is slang for swallowing l..

Ozone Layer

1. ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depl..

Un-cut

1. 1. not edited shortened or censored 2. uncircumcised 3. having to do with a illegal drug with no additional chemicals I am not go..

All you need for a faster workflow in one place.

Birken-nots Edit Meaning