What is Good Going?
1.
Used when someone does something really stupid. It is also used when someone, who is really
Can also be shortened by an abbreviated term gg.
Guy 1: Your momma so poor she has to use coupons at the 99 cent store!
Guy 2: *long pause, maybe 3 minutes*
Guy 1: Do you need me to repeat that for you?
Guy 2: OH! AHAHA nice one, I get it.
Guy 1: Wow good going dude...
Guy 1: What are you doing, you can't turn the TV on, when the remote is pointing at you.
Guy 2: Oh I didn't even realize it was pointing at me.
Guy 1: GG
See
Random Words:
1.
ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depl..
1.
Used to address the end of the line in an escalated conversation, debate or exchange. A loss of temper or patience is often the catalyst..
1.
The smelly cottage cheese like crap that is found under a mans bells.
The maintence guy never takes a shower he probably has the worst ..
