What is Ozone Layer?
1.
ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depleting the ozone layer.CFCs can takes up to 8 years to reach the atmosphere.Once there,it will start breaking up ozone molecule and more UV ray(UVB) penetrate to the Earth.
As a result,people get cataract whih will lead to blindness,skin cancer which might peel off ur skin.
The ozone layer, or ozonosphere layer (rarely used term), is the part of the Earth's concentrations of ozone (O3).
See
Random Words:
1.
Its when someone puts some of their pubic hairs on your Mars bar and then you eat it.
Yummy i just had a Middle Eastern Mars bar!
See ..
1.
a sarcastic response to, 'isn't it a little early to be drinking?'
'I know it's still morning here, but hey, i..
