What is Ozone Layer?
1.
ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depleting the ozone layer.CFCs can takes up to 8 years to reach the atmosphere.Once there,it will start breaking up ozone molecule and more UV ray(UVB) penetrate to the Earth.
As a result,people get cataract whih will lead to blindness,skin cancer which might peel off ur skin.
The ozone layer, or ozonosphere layer (rarely used term), is the part of the Earth's concentrations of ozone (O3).
See
Random Words:
1.
Urban Dictionary Tyrants are vicious little maggots and assorted other worms that, failing to comprehend nearly 95% of what they purport..
