What is Ozone Layer?
1.
ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depleting the ozone layer.CFCs can takes up to 8 years to reach the atmosphere.Once there,it will start breaking up ozone molecule and more UV ray(UVB) penetrate to the Earth.
As a result,people get cataract whih will lead to blindness,skin cancer which might peel off ur skin.
The ozone layer, or ozonosphere layer (rarely used term), is the part of the Earth's concentrations of ozone (O3).
See
Random Words:
1.
A yard truck is a truck that is not roadworthy, or registered, will not pass inspection, and is only used off road. Typically used in th..
1.
Basket ball taken to the extreme, sort of a mixture of Rugbee and football and basketball, anything goes.
Frankie:Hey Miguel lets play ..
