Ozone Layer

What is Ozone Layer?


1.

ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depleting the ozone layer.CFCs can takes up to 8 years to reach the atmosphere.Once there,it will start breaking up ozone molecule and more UV ray(UVB) penetrate to the Earth.

As a result,people get cataract whih will lead to blindness,skin cancer which might peel off ur skin.

The ozone layer, or ozonosphere layer (rarely used term), is the part of the Earth's concentrations of ozone (O3).

See ozone layer, stratosphere


11

Random Words:

1. is any gangster how fails to complete gangster initiation. in the hierarchy of the hood a quasi-gangster beats a psuedo-gangster. or som..
1. Definition 1: Word used to express excitement within friends. Usually used as a greeting to let your presence known. Defintion 2: univ..
1. When you get owned by Garbo. Coined by MissYau. I was on blogtv last night, I got garbowned. =( See garbo, youtube, blogtv, twitter, ..