Pet Shop

What is Pet Shop?

A girl that's slept around a lot, also known as a slapper..

That Irene, she's like a pet shop, i bet she's had a cockatoo (cock or two) in her time...

Jewisher

1. The extension of ones Judaism, by per taking in actions that are extra Jewish. Dude did that Rabi get Jewisher or is it just me? See k..

Munichies

1. State of drug induced hunger caused by smoking marijuana in Germany. "That was a killer spliff, Hans but now I need some bratwurst..

Ozone Layer

1. ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depl..

All you need for a faster workflow in one place.

Pet Shop Edit Meaning