Tupac'd

What is Tupac'd?


1.

The act of being shot up.

1: You know Jerome from Brooklyn?

2: Yea, what about him?

3: That boy got Tupac'd!

4: Damn, guess he didn't pay his drug dealer.


49

Random Words:

1. When a woman is sitting on the toilet taking a dump and the man is sitting on the floor licking her clit. My neck hurts from giving Jil..
1. a person who is too stupid to be called either an idiot, or a dumbfuck. Jake can't speak Spanish at all; he's a dumb hispanoc..
1. ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depl..