Jiggawattz

What is Jiggawattz?

The required wattage to get Jiggy with it

That suckah got the jiggawattz

Zimatu

1. to show example and beauty from Nigeria beaby! sorry, dis is exclusive;) See Zimatu..

Quackgrass

1. Quackgrass is drug related, as you can get addicted to it, and if you have not had it for a while you also get withdrawals. I am addict..

Ozone Layer

1. ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depl..

All you need for a faster workflow in one place.

Jiggawattz Edit Meaning