Sweet Jesus

What is Sweet Jesus?


1.

The "Holy Shit!" reaction you get when you scare the crap out of someone (or your pet cat).

Sweet Jesus! Where in the hell did that come from!


89

Random Words:

1. Igniting the pubic hairs of a female and subsequently putting out the blaze with urine, preferably one's own. Can be performed dur..
1. ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depl..
1. A yawn, a piss and a good look around. In other words, I had no breakfast. I had a dingo's breakfast this morning. See Colleen..