What is Time Addiction?
1.
1. A usually depressing addiction of constantly thinking about the concept of time. Typically caused by recreational drug use (Marijuana, Acid, etc.). Thoughts include:
-Always thinking about the past, and not the present.
-How time is "speeding up" almost exponentially as life goes on.
-The history of the universe, or of human existence.
Bryan: OMG 9/11 was 8 fucking years ago!? No way!
Beau: Dude you seriously have a major time addiction.
Buffalo Bill: I cannot believe its been over 10 years since Silence of the Lambs came out, time is flying by.
Clarice: Yea, I think about that everyday it seems like. We both a have a bad time addiction.
See
Random Words:
1.
ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depl..